4,5-dimethylocta-3,5-dienedioic acid

C10H14O4 — CID 57299437

IUPAC4,5-dimethylocta-3,5-dienedioic acid
SMILESCC(=CCC(=O)O)C(C)=CCC(=O)O
InChIInChI=1S/C10H14O4/c1-7(3-5-9(11)12)8(2)4-6-10(13)14/h3-4H,5-6H2,1-2H3,(H,11,12)(H,13,14)
InChIKeyZUUBNDAKKBXREV-UHFFFAOYSA-N
MW198.22 g/mol
LogP1.83
Rot. Bonds5

About 4,5-dimethylocta-3,5-dienedioic acid

4,5-dimethylocta-3,5-dienedioic acid (PubChem CID 57299437) has the molecular formula C10H14O4 and a molecular weight of 198.22 g/mol. Its IUPAC name is 4,5-dimethylocta-3,5-dienedioic acid.

Molecular Properties

Compound Name4,5-dimethylocta-3,5-dienedioic acid
PubChem CID57299437
Molecular FormulaC10H14O4
Molecular Weight198.22 g/mol
Exact Mass198.09
IUPAC Name4,5-dimethylocta-3,5-dienedioic acid
SMILESCC(=CCC(=O)O)C(C)=CCC(=O)O
InChIInChI=1S/C10H14O4/c1-7(3-5-9(11)12)8(2)4-6-10(13)14/h3-4H,5-6H2,1-2H3,(H,11,12)(H,13,14)
InChIKeyZUUBNDAKKBXREV-UHFFFAOYSA-N
XLogP1.83
TPSA74.60 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds5
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500198.22
LogP ≤ 51.83
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'polyene', 'substructure': 'N/A'}

Analyze 4,5-dimethylocta-3,5-dienedioic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4,5-dimethylocta-3,5-dienedioic acid?
The IUPAC name of 4,5-dimethylocta-3,5-dienedioic acid (CID 57299437) is 4,5-dimethylocta-3,5-dienedioic acid.
What is the SMILES notation for 4,5-dimethylocta-3,5-dienedioic acid?
The canonical SMILES for 4,5-dimethylocta-3,5-dienedioic acid is CC(=CCC(=O)O)C(C)=CCC(=O)O.
What is the InChIKey of 4,5-dimethylocta-3,5-dienedioic acid?
The InChIKey is ZUUBNDAKKBXREV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14O4/c1-7(3-5-9(11)12)8(2)4-6-10(13)14/h3-4H,5-6H2,1-2H3,(H,11,12)(H,13,14).
What are the key properties of 4,5-dimethylocta-3,5-dienedioic acid?
4,5-dimethylocta-3,5-dienedioic acid has a molecular weight of 198.22 g/mol, XLogP of 1.83, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dimethylocta-3,5-dienedioic acid is sourced from PubChem (CID 57299437), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).