C14H20O5 — CID 88632469
buta-1,3-diene;5-(2-hydroxyethoxycarbonyl)-2-methylhexa-2,5-dienoic acid (PubChem CID 88632469) has the molecular formula C14H20O5 and a molecular weight of 268.31 g/mol. Its IUPAC name is buta-1,3-diene;5-(2-hydroxyethoxycarbonyl)-2-methylhexa-2,5-dienoic acid.
| Compound Name | buta-1,3-diene;5-(2-hydroxyethoxycarbonyl)-2-methylhexa-2,5-dienoic acid |
|---|---|
| PubChem CID | 88632469 |
| Molecular Formula | C14H20O5 |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | buta-1,3-diene;5-(2-hydroxyethoxycarbonyl)-2-methylhexa-2,5-dienoic acid |
| SMILES | C=C(CC=C(C)C(=O)O)C(=O)OCCO.C=CC=C |
| InChI | InChI=1S/C10H14O5.C4H6/c1-7(9(12)13)3-4-8(2)10(14)15-6-5-11;1-3-4-2/h3,11H,2,4-6H2,1H3,(H,12,13);3-4H,1-2H2 |
| InChIKey | AFTQUNQQGSETAQ-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|