C23H30O7 — CID 118105806
5-(2-hydroxyethoxycarbonyl)-2-methylhexa-2,5-dienoic acid;methyl 2-methylprop-2-enoate;styrene (PubChem CID 118105806) has the molecular formula C23H30O7 and a molecular weight of 418.49 g/mol. Its IUPAC name is 5-(2-hydroxyethoxycarbonyl)-2-methylhexa-2,5-dienoic acid;methyl 2-methylprop-2-enoate;styrene.
| Compound Name | 5-(2-hydroxyethoxycarbonyl)-2-methylhexa-2,5-dienoic acid;methyl 2-methylprop-2-enoate;styrene |
|---|---|
| PubChem CID | 118105806 |
| Molecular Formula | C23H30O7 |
| Molecular Weight | 418.49 g/mol |
| Exact Mass | 418.20 |
| IUPAC Name | 5-(2-hydroxyethoxycarbonyl)-2-methylhexa-2,5-dienoic acid;methyl 2-methylprop-2-enoate;styrene |
| SMILES | C=C(C)C(=O)OC.C=C(CC=C(C)C(=O)O)C(=O)OCCO.C=Cc1ccccc1 |
| InChI | InChI=1S/C10H14O5.C8H8.C5H8O2/c1-7(9(12)13)3-4-8(2)10(14)15-6-5-11;1-2-8-6-4-3-5-7-8;1-4(2)5(6)7-3/h3,11H,2,4-6H2,1H3,(H,12,13);2-7H,1H2;1H2,2-3H3 |
| InChIKey | HUKFELFIWORYIN-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.49 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|