C23H36O9 — CID 87698899
butyl 2-methylprop-2-enoate;2-hydroxyethyl 2-methylprop-2-enoate;5-methoxycarbonyl-2-methylhexa-2,5-dienoic acid (PubChem CID 87698899) has the molecular formula C23H36O9 and a molecular weight of 456.53 g/mol. Its IUPAC name is butyl 2-methylprop-2-enoate;2-hydroxyethyl 2-methylprop-2-enoate;5-methoxycarbonyl-2-methylhexa-2,5-dienoic acid.
| Compound Name | butyl 2-methylprop-2-enoate;2-hydroxyethyl 2-methylprop-2-enoate;5-methoxycarbonyl-2-methylhexa-2,5-dienoic acid |
|---|---|
| PubChem CID | 87698899 |
| Molecular Formula | C23H36O9 |
| Molecular Weight | 456.53 g/mol |
| Exact Mass | 456.24 |
| IUPAC Name | butyl 2-methylprop-2-enoate;2-hydroxyethyl 2-methylprop-2-enoate;5-methoxycarbonyl-2-methylhexa-2,5-dienoic acid |
| SMILES | C=C(C)C(=O)OCCCC.C=C(C)C(=O)OCCO.C=C(CC=C(C)C(=O)O)C(=O)OC |
| InChI | InChI=1S/C9H12O4.C8H14O2.C6H10O3/c1-6(8(10)11)4-5-7(2)9(12)13-3;1-4-5-6-10-8(9)7(2)3;1-5(2)6(8)9-4-3-7/h4H,2,5H2,1,3H3,(H,10,11);2,4-6H2,1,3H3;7H,1,3-4H2,2H3 |
| InChIKey | IXMWVQWDOOGAOX-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 136.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.53 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|