C18H30O5 — CID 67600613
2-methyl-5-(2-octoxyethoxycarbonyl)hexa-2,5-dienoic acid (PubChem CID 67600613) has the molecular formula C18H30O5 and a molecular weight of 326.43 g/mol. Its IUPAC name is 2-methyl-5-(2-octoxyethoxycarbonyl)hexa-2,5-dienoic acid.
| Compound Name | 2-methyl-5-(2-octoxyethoxycarbonyl)hexa-2,5-dienoic acid |
|---|---|
| PubChem CID | 67600613 |
| Molecular Formula | C18H30O5 |
| Molecular Weight | 326.43 g/mol |
| Exact Mass | 326.21 |
| IUPAC Name | 2-methyl-5-(2-octoxyethoxycarbonyl)hexa-2,5-dienoic acid |
| SMILES | C=C(CC=C(C)C(=O)O)C(=O)OCCOCCCCCCCC |
| InChI | InChI=1S/C18H30O5/c1-4-5-6-7-8-9-12-22-13-14-23-18(21)16(3)11-10-15(2)17(19)20/h10H,3-9,11-14H2,1-2H3,(H,19,20) |
| InChIKey | WVZGPGWTGFFNBZ-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.43 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|