C14H20O7 — CID 122471335
5-(2-hydroxyethoxycarbonyl)hexa-2,5-dienoic acid;methyl 2-methylprop-2-enoate (PubChem CID 122471335) has the molecular formula C14H20O7 and a molecular weight of 300.31 g/mol. Its IUPAC name is 5-(2-hydroxyethoxycarbonyl)hexa-2,5-dienoic acid;methyl 2-methylprop-2-enoate.
| Compound Name | 5-(2-hydroxyethoxycarbonyl)hexa-2,5-dienoic acid;methyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 122471335 |
| Molecular Formula | C14H20O7 |
| Molecular Weight | 300.31 g/mol |
| Exact Mass | 300.12 |
| IUPAC Name | 5-(2-hydroxyethoxycarbonyl)hexa-2,5-dienoic acid;methyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC.C=C(CC=CC(=O)O)C(=O)OCCO |
| InChI | InChI=1S/C9H12O5.C5H8O2/c1-7(3-2-4-8(11)12)9(13)14-6-5-10;1-4(2)5(6)7-3/h2,4,10H,1,3,5-6H2,(H,11,12);1H2,2-3H3 |
| InChIKey | XLJVIWXVRMCVEI-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.31 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|