C10H13F3O4 — CID 87690225
methyl 2-methylprop-2-enoate;5,5,5-trifluoropent-2-enoic acid (PubChem CID 87690225) has the molecular formula C10H13F3O4 and a molecular weight of 254.20 g/mol. Its IUPAC name is methyl 2-methylprop-2-enoate;5,5,5-trifluoropent-2-enoic acid.
| Compound Name | methyl 2-methylprop-2-enoate;5,5,5-trifluoropent-2-enoic acid |
|---|---|
| PubChem CID | 87690225 |
| Molecular Formula | C10H13F3O4 |
| Molecular Weight | 254.20 g/mol |
| Exact Mass | 254.08 |
| IUPAC Name | methyl 2-methylprop-2-enoate;5,5,5-trifluoropent-2-enoic acid |
| SMILES | C=C(C)C(=O)OC.O=C(O)C=CCC(F)(F)F |
| InChI | InChI=1S/C5H5F3O2.C5H8O2/c6-5(7,8)3-1-2-4(9)10;1-4(2)5(6)7-3/h1-2H,3H2,(H,9,10);1H2,2-3H3 |
| InChIKey | ZJQRJWPQCGHWGM-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.20 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|