methyl 2-methylprop-2-enoate;5,5,5-trifluoropent-2-enoic acid

C10H13F3O4 — CID 87690225

IUPACmethyl 2-methylprop-2-enoate;5,5,5-trifluoropent-2-enoic acid
SMILESC=C(C)C(=O)OC.O=C(O)C=CCC(F)(F)F
InChIInChI=1S/C5H5F3O2.C5H8O2/c6-5(7,8)3-1-2-4(9)10;1-4(2)5(6)7-3/h1-2H,3H2,(H,9,10);1H2,2-3H3
InChIKeyZJQRJWPQCGHWGM-UHFFFAOYSA-N
MW254.20 g/mol
LogP2.32
Rot. Bonds3

About methyl 2-methylprop-2-enoate;5,5,5-trifluoropent-2-enoic acid

methyl 2-methylprop-2-enoate;5,5,5-trifluoropent-2-enoic acid (PubChem CID 87690225) has the molecular formula C10H13F3O4 and a molecular weight of 254.20 g/mol. Its IUPAC name is methyl 2-methylprop-2-enoate;5,5,5-trifluoropent-2-enoic acid.

Molecular Properties

Compound Namemethyl 2-methylprop-2-enoate;5,5,5-trifluoropent-2-enoic acid
PubChem CID87690225
Molecular FormulaC10H13F3O4
Molecular Weight254.20 g/mol
Exact Mass254.08
IUPAC Namemethyl 2-methylprop-2-enoate;5,5,5-trifluoropent-2-enoic acid
SMILESC=C(C)C(=O)OC.O=C(O)C=CCC(F)(F)F
InChIInChI=1S/C5H5F3O2.C5H8O2/c6-5(7,8)3-1-2-4(9)10;1-4(2)5(6)7-3/h1-2H,3H2,(H,9,10);1H2,2-3H3
InChIKeyZJQRJWPQCGHWGM-UHFFFAOYSA-N
XLogP2.32
TPSA63.60 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500254.20
LogP ≤ 52.32
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze methyl 2-methylprop-2-enoate;5,5,5-trifluoropent-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-methylprop-2-enoate;5,5,5-trifluoropent-2-enoic acid?
The IUPAC name of methyl 2-methylprop-2-enoate;5,5,5-trifluoropent-2-enoic acid (CID 87690225) is methyl 2-methylprop-2-enoate;5,5,5-trifluoropent-2-enoic acid.
What is the SMILES notation for methyl 2-methylprop-2-enoate;5,5,5-trifluoropent-2-enoic acid?
The canonical SMILES for methyl 2-methylprop-2-enoate;5,5,5-trifluoropent-2-enoic acid is C=C(C)C(=O)OC.O=C(O)C=CCC(F)(F)F.
What is the InChIKey of methyl 2-methylprop-2-enoate;5,5,5-trifluoropent-2-enoic acid?
The InChIKey is ZJQRJWPQCGHWGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5F3O2.C5H8O2/c6-5(7,8)3-1-2-4(9)10;1-4(2)5(6)7-3/h1-2H,3H2,(H,9,10);1H2,2-3H3.
What are the key properties of methyl 2-methylprop-2-enoate;5,5,5-trifluoropent-2-enoic acid?
methyl 2-methylprop-2-enoate;5,5,5-trifluoropent-2-enoic acid has a molecular weight of 254.20 g/mol, XLogP of 2.32, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-methylprop-2-enoate;5,5,5-trifluoropent-2-enoic acid is sourced from PubChem (CID 87690225), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).