C49H82O6 — CID 67601188
5-(2-cyclohexylethoxycarbonyl)-2-methylhexa-2,5-dienoic acid;2,3,3-tri(cyclodecyl)prop-2-enoic acid (PubChem CID 67601188) has the molecular formula C49H82O6 and a molecular weight of 767.19 g/mol. Its IUPAC name is 5-(2-cyclohexylethoxycarbonyl)-2-methylhexa-2,5-dienoic acid;2,3,3-tri(cyclodecyl)prop-2-enoic acid.
| Compound Name | 5-(2-cyclohexylethoxycarbonyl)-2-methylhexa-2,5-dienoic acid;2,3,3-tri(cyclodecyl)prop-2-enoic acid |
|---|---|
| PubChem CID | 67601188 |
| Molecular Formula | C49H82O6 |
| Molecular Weight | 767.19 g/mol |
| Exact Mass | 766.61 |
| IUPAC Name | 5-(2-cyclohexylethoxycarbonyl)-2-methylhexa-2,5-dienoic acid;2,3,3-tri(cyclodecyl)prop-2-enoic acid |
| SMILES | C=C(CC=C(C)C(=O)O)C(=O)OCCC1CCCCC1.O=C(O)C(=C(C1CCCCCCCCC1)C1CCCCCCCCC1)C1CCCCCCCCC1 |
| InChI | InChI=1S/C33H58O2.C16H24O4/c34-33(35)32(30-26-20-14-8-3-9-15-21-27-30)31(28-22-16-10-4-1-5-11-17-23-28)29-24-18-12-6-2-7-13-19-25-29;1-12(15(17)18)8-9-13(2)16(19)20-11-10-14-6-4-3-5-7-14/h28-30H,1-27H2,(H,34,35);8,14H,2-7,9-11H2,1H3,(H,17,18) |
| InChIKey | GGTOHADGNYJPCA-UHFFFAOYSA-N |
| XLogP | 14.27 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 767.19 |
| LogP ≤ 5 | 14.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|