C28H34F2O2 — CID 123981355
4,17-difluoro-3,6,7,10,15,18-hexamethyl-11,14-dimethylideneicosa-3,5,7,9,12,15,17-heptaene-2,19-dione (PubChem CID 123981355) has the molecular formula C28H34F2O2 and a molecular weight of 440.57 g/mol. Its IUPAC name is 4,17-difluoro-3,6,7,10,15,18-hexamethyl-11,14-dimethylideneicosa-3,5,7,9,12,15,17-heptaene-2,19-dione.
| Compound Name | 4,17-difluoro-3,6,7,10,15,18-hexamethyl-11,14-dimethylideneicosa-3,5,7,9,12,15,17-heptaene-2,19-dione |
|---|---|
| PubChem CID | 123981355 |
| Molecular Formula | C28H34F2O2 |
| Molecular Weight | 440.57 g/mol |
| Exact Mass | 440.25 |
| IUPAC Name | 4,17-difluoro-3,6,7,10,15,18-hexamethyl-11,14-dimethylideneicosa-3,5,7,9,12,15,17-heptaene-2,19-dione |
| SMILES | C=C(C=CC(=C)C(C)=CC(F)=C(C)C(C)=O)C(C)=CC=C(C)C(C)=CC(F)=C(C)C(C)=O |
| InChI | InChI=1S/C28H34F2O2/c1-17(11-13-19(3)21(5)15-27(29)23(7)25(9)31)18(2)12-14-20(4)22(6)16-28(30)24(8)26(10)32/h11-16H,1,3H2,2,4-10H3 |
| InChIKey | CGXDXDJRFHIXNB-UHFFFAOYSA-N |
| XLogP | 8.11 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.57 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|