C8H8BrFO — CID 143571697
(3Z)-5-bromo-3-(1-fluoroethenyl)hexa-3,5-dien-2-one (PubChem CID 143571697) has the molecular formula C8H8BrFO and a molecular weight of 219.05 g/mol. Its IUPAC name is (3Z)-5-bromo-3-(1-fluoroethenyl)hexa-3,5-dien-2-one.
| Compound Name | (3Z)-5-bromo-3-(1-fluoroethenyl)hexa-3,5-dien-2-one |
|---|---|
| PubChem CID | 143571697 |
| Molecular Formula | C8H8BrFO |
| Molecular Weight | 219.05 g/mol |
| Exact Mass | 217.97 |
| IUPAC Name | (3Z)-5-bromo-3-(1-fluoroethenyl)hexa-3,5-dien-2-one |
| SMILES | C=C(Br)/C=C(\C(=C)F)C(C)=O |
| InChI | InChI=1S/C8H8BrFO/c1-5(9)4-8(6(2)10)7(3)11/h4H,1-2H2,3H3/b8-4+ |
| InChIKey | FVUNKQPFRRUAIZ-XBXARRHUSA-N |
| XLogP | 2.89 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.05 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|