C7H8BrFO2S — CID 145014902
(3E)-5-bromo-2-fluoro-3-methylsulfonylhexa-1,3,5-triene (PubChem CID 145014902) has the molecular formula C7H8BrFO2S and a molecular weight of 255.11 g/mol. Its IUPAC name is (3E)-5-bromo-2-fluoro-3-methylsulfonylhexa-1,3,5-triene.
| Compound Name | (3E)-5-bromo-2-fluoro-3-methylsulfonylhexa-1,3,5-triene |
|---|---|
| PubChem CID | 145014902 |
| Molecular Formula | C7H8BrFO2S |
| Molecular Weight | 255.11 g/mol |
| Exact Mass | 253.94 |
| IUPAC Name | (3E)-5-bromo-2-fluoro-3-methylsulfonylhexa-1,3,5-triene |
| SMILES | C=C(Br)/C=C(\C(=C)F)S(C)(=O)=O |
| InChI | InChI=1S/C7H8BrFO2S/c1-5(8)4-7(6(2)9)12(3,10)11/h4H,1-2H2,3H3/b7-4+ |
| InChIKey | NYYCNPMOLAVTNL-QPJJXVBHSA-N |
| XLogP | 2.31 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.11 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|