C10H15BrFNO — CID 155697944
2-[(3E)-5-bromo-2-fluorohexa-1,3,5-trien-3-yl]oxy-N,N-dimethylethanamine (PubChem CID 155697944) has the molecular formula C10H15BrFNO and a molecular weight of 264.14 g/mol. Its IUPAC name is 2-[(3E)-5-bromo-2-fluorohexa-1,3,5-trien-3-yl]oxy-N,N-dimethylethanamine.
| Compound Name | 2-[(3E)-5-bromo-2-fluorohexa-1,3,5-trien-3-yl]oxy-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 155697944 |
| Molecular Formula | C10H15BrFNO |
| Molecular Weight | 264.14 g/mol |
| Exact Mass | 263.03 |
| IUPAC Name | 2-[(3E)-5-bromo-2-fluorohexa-1,3,5-trien-3-yl]oxy-N,N-dimethylethanamine |
| SMILES | C=C(Br)/C=C(/OCCN(C)C)C(=C)F |
| InChI | InChI=1S/C10H15BrFNO/c1-8(11)7-10(9(2)12)14-6-5-13(3)4/h7H,1-2,5-6H2,3-4H3/b10-7+ |
| InChIKey | MDDYTYHTKFUAFT-JXMROGBWSA-N |
| XLogP | 2.84 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.14 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|