C7H9BrO2 — CID 171072212
(3E)-5-bromo-3-methoxyhexa-1,3,5-trien-2-ol (PubChem CID 171072212) has the molecular formula C7H9BrO2 and a molecular weight of 205.05 g/mol. Its IUPAC name is (3E)-5-bromo-3-methoxyhexa-1,3,5-trien-2-ol.
| Compound Name | (3E)-5-bromo-3-methoxyhexa-1,3,5-trien-2-ol |
|---|---|
| PubChem CID | 171072212 |
| Molecular Formula | C7H9BrO2 |
| Molecular Weight | 205.05 g/mol |
| Exact Mass | 203.98 |
| IUPAC Name | (3E)-5-bromo-3-methoxyhexa-1,3,5-trien-2-ol |
| SMILES | C=C(Br)/C=C(/OC)C(=C)O |
| InChI | InChI=1S/C7H9BrO2/c1-5(8)4-7(10-3)6(2)9/h4,9H,1-2H2,3H3/b7-4+ |
| InChIKey | RLQJZIFYLACNMM-QPJJXVBHSA-N |
| XLogP | 2.50 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.05 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|