C10H14O3 — CID 88612999
(3E,5E)-5-hydroxy-4-methoxy-7-methylocta-3,5,7-trienal (PubChem CID 88612999) has the molecular formula C10H14O3 and a molecular weight of 182.22 g/mol. Its IUPAC name is (3E,5E)-5-hydroxy-4-methoxy-7-methylocta-3,5,7-trienal.
| Compound Name | (3E,5E)-5-hydroxy-4-methoxy-7-methylocta-3,5,7-trienal |
|---|---|
| PubChem CID | 88612999 |
| Molecular Formula | C10H14O3 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.09 |
| IUPAC Name | (3E,5E)-5-hydroxy-4-methoxy-7-methylocta-3,5,7-trienal |
| SMILES | C=C(C)/C=C(O)\C(=C/CC=O)OC |
| InChI | InChI=1S/C10H14O3/c1-8(2)7-9(12)10(13-3)5-4-6-11/h5-7,12H,1,4H2,2-3H3/b9-7+,10-5+ |
| InChIKey | ZRYIGMTWRVENFK-JCVPOOLXSA-N |
| XLogP | 2.12 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|