C6H10O2 — CID 134856405
(1E)-1-methoxy-3-methylbuta-1,3-dien-1-ol (PubChem CID 134856405) has the molecular formula C6H10O2 and a molecular weight of 114.14 g/mol. Its IUPAC name is (1E)-1-methoxy-3-methylbuta-1,3-dien-1-ol.
| Compound Name | (1E)-1-methoxy-3-methylbuta-1,3-dien-1-ol |
|---|---|
| PubChem CID | 134856405 |
| Molecular Formula | C6H10O2 |
| Molecular Weight | 114.14 g/mol |
| Exact Mass | 114.07 |
| IUPAC Name | (1E)-1-methoxy-3-methylbuta-1,3-dien-1-ol |
| SMILES | C=C(C)/C=C(\O)OC |
| InChI | InChI=1S/C6H10O2/c1-5(2)4-6(7)8-3/h4,7H,1H2,2-3H3/b6-4+ |
| InChIKey | LDXWBHNCQRWCGB-GQCTYLIASA-N |
| XLogP | 1.61 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 114.14 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|