C11H20O — CID 142883560
(3Z,5R)-4-methoxy-2,5,6-trimethylhepta-1,3-diene (PubChem CID 142883560) has the molecular formula C11H20O and a molecular weight of 168.28 g/mol. Its IUPAC name is (3Z,5R)-4-methoxy-2,5,6-trimethylhepta-1,3-diene.
| Compound Name | (3Z,5R)-4-methoxy-2,5,6-trimethylhepta-1,3-diene |
|---|---|
| PubChem CID | 142883560 |
| Molecular Formula | C11H20O |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.15 |
| IUPAC Name | (3Z,5R)-4-methoxy-2,5,6-trimethylhepta-1,3-diene |
| SMILES | C=C(C)/C=C(\OC)[C@H](C)C(C)C |
| InChI | InChI=1S/C11H20O/c1-8(2)7-11(12-6)10(5)9(3)4/h7,9-10H,1H2,2-6H3/b11-7-/t10-/m1/s1 |
| InChIKey | QOUWHHSCNHUHCV-PAKSIRSJSA-N |
| XLogP | 3.38 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|