C11H19NO — CID 123158046
6-methoxy-N,N,4-trimethylhepta-2,4,6-trien-2-amine (PubChem CID 123158046) has the molecular formula C11H19NO and a molecular weight of 181.28 g/mol. Its IUPAC name is 6-methoxy-N,N,4-trimethylhepta-2,4,6-trien-2-amine.
| Compound Name | 6-methoxy-N,N,4-trimethylhepta-2,4,6-trien-2-amine |
|---|---|
| PubChem CID | 123158046 |
| Molecular Formula | C11H19NO |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.15 |
| IUPAC Name | 6-methoxy-N,N,4-trimethylhepta-2,4,6-trien-2-amine |
| SMILES | C=C(C=C(C)C=C(C)N(C)C)OC |
| InChI | InChI=1S/C11H19NO/c1-9(8-11(3)13-6)7-10(2)12(4)5/h7-8H,3H2,1-2,4-6H3 |
| InChIKey | UZLOALUIUBHHTA-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|