C11H17N3 — CID 143342843
(2Z)-N,N-dimethyl-4-[(E)-2-(methylideneamino)ethenyl]iminohexa-2,5-dien-2-amine (PubChem CID 143342843) has the molecular formula C11H17N3 and a molecular weight of 191.28 g/mol. Its IUPAC name is (2Z)-N,N-dimethyl-4-[(E)-2-(methylideneamino)ethenyl]iminohexa-2,5-dien-2-amine.
| Compound Name | (2Z)-N,N-dimethyl-4-[(E)-2-(methylideneamino)ethenyl]iminohexa-2,5-dien-2-amine |
|---|---|
| PubChem CID | 143342843 |
| Molecular Formula | C11H17N3 |
| Molecular Weight | 191.28 g/mol |
| Exact Mass | 191.14 |
| IUPAC Name | (2Z)-N,N-dimethyl-4-[(E)-2-(methylideneamino)ethenyl]iminohexa-2,5-dien-2-amine |
| SMILES | C=CC(/C=C(/C)N(C)C)=N\C=C\N=C |
| InChI | InChI=1S/C11H17N3/c1-6-11(13-8-7-12-3)9-10(2)14(4)5/h6-9H,1,3H2,2,4-5H3/b8-7+,10-9-,13-11+ |
| InChIKey | OONUCIPYCOZDRA-UGGNJXSJSA-N |
| XLogP | 2.25 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.28 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|