C8H18N2 — CID 143693608
N,N-dimethylethanamine;N-[(Z)-prop-1-enyl]methanimine (PubChem CID 143693608) has the molecular formula C8H18N2 and a molecular weight of 142.25 g/mol. Its IUPAC name is N,N-dimethylethanamine;N-[(Z)-prop-1-enyl]methanimine.
| Compound Name | N,N-dimethylethanamine;N-[(Z)-prop-1-enyl]methanimine |
|---|---|
| PubChem CID | 143693608 |
| Molecular Formula | C8H18N2 |
| Molecular Weight | 142.25 g/mol |
| Exact Mass | 142.15 |
| IUPAC Name | N,N-dimethylethanamine;N-[(Z)-prop-1-enyl]methanimine |
| SMILES | C=N/C=C\C.CCN(C)C |
| InChI | InChI=1S/C4H11N.C4H7N/c1-4-5(2)3;1-3-4-5-2/h4H2,1-3H3;3-4H,2H2,1H3/b;4-3- |
| InChIKey | RBGDZMKMQAYKHC-QGAMPUOQSA-N |
| XLogP | 1.79 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.25 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|