C8H13F3N2 — CID 59782155
(Z)-5,5,5-trifluoro-N,N-dimethyl-4-methyliminopent-2-en-2-amine (PubChem CID 59782155) has the molecular formula C8H13F3N2 and a molecular weight of 194.20 g/mol. Its IUPAC name is (Z)-5,5,5-trifluoro-N,N-dimethyl-4-methyliminopent-2-en-2-amine.
| Compound Name | (Z)-5,5,5-trifluoro-N,N-dimethyl-4-methyliminopent-2-en-2-amine |
|---|---|
| PubChem CID | 59782155 |
| Molecular Formula | C8H13F3N2 |
| Molecular Weight | 194.20 g/mol |
| Exact Mass | 194.10 |
| IUPAC Name | (Z)-5,5,5-trifluoro-N,N-dimethyl-4-methyliminopent-2-en-2-amine |
| SMILES | C/N=C(/C=C(/C)N(C)C)C(F)(F)F |
| InChI | InChI=1S/C8H13F3N2/c1-6(13(3)4)5-7(12-2)8(9,10)11/h5H,1-4H3/b6-5-,12-7- |
| InChIKey | ZJTKGJNOWXCRAV-VZVVJSHISA-N |
| XLogP | 2.08 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.20 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|