C10H14F3N — CID 134219972
(Z)-N-[(E)-1,1,1-trifluoropent-2-en-2-yl]pent-3-en-2-imine (PubChem CID 134219972) has the molecular formula C10H14F3N and a molecular weight of 205.22 g/mol. Its IUPAC name is (Z)-N-[(E)-1,1,1-trifluoropent-2-en-2-yl]pent-3-en-2-imine.
| Compound Name | (Z)-N-[(E)-1,1,1-trifluoropent-2-en-2-yl]pent-3-en-2-imine |
|---|---|
| PubChem CID | 134219972 |
| Molecular Formula | C10H14F3N |
| Molecular Weight | 205.22 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | (Z)-N-[(E)-1,1,1-trifluoropent-2-en-2-yl]pent-3-en-2-imine |
| SMILES | C/C=C\C(C)=N\C(=C\CC)C(F)(F)F |
| InChI | InChI=1S/C10H14F3N/c1-4-6-8(3)14-9(7-5-2)10(11,12)13/h4,6-7H,5H2,1-3H3/b6-4-,9-7+,14-8+ |
| InChIKey | VRZJZRUFXOPFOA-JGCCJHDESA-N |
| XLogP | 3.88 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.22 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|