C8H8F3N — CID 123927403
6-methyl-2-methylidene-4-(trifluoromethyl)-3H-pyridine (PubChem CID 123927403) has the molecular formula C8H8F3N and a molecular weight of 175.15 g/mol. Its IUPAC name is 6-methyl-2-methylidene-4-(trifluoromethyl)-3H-pyridine.
| Compound Name | 6-methyl-2-methylidene-4-(trifluoromethyl)-3H-pyridine |
|---|---|
| PubChem CID | 123927403 |
| Molecular Formula | C8H8F3N |
| Molecular Weight | 175.15 g/mol |
| Exact Mass | 175.06 |
| IUPAC Name | 6-methyl-2-methylidene-4-(trifluoromethyl)-3H-pyridine |
| SMILES | C=C1CC(C(F)(F)F)=CC(C)=N1 |
| InChI | InChI=1S/C8H8F3N/c1-5-3-7(8(9,10)11)4-6(2)12-5/h4H,1,3H2,2H3 |
| InChIKey | VYWHQQZIZBQSPK-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.15 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |