C13H22F3N — CID 153342667
propane;(E)-1,1,1-trifluoro-4-methyl-N-prop-1-en-2-ylhex-3-en-2-imine (PubChem CID 153342667) has the molecular formula C13H22F3N and a molecular weight of 249.32 g/mol. Its IUPAC name is propane;(E)-1,1,1-trifluoro-4-methyl-N-prop-1-en-2-ylhex-3-en-2-imine.
| Compound Name | propane;(E)-1,1,1-trifluoro-4-methyl-N-prop-1-en-2-ylhex-3-en-2-imine |
|---|---|
| PubChem CID | 153342667 |
| Molecular Formula | C13H22F3N |
| Molecular Weight | 249.32 g/mol |
| Exact Mass | 249.17 |
| IUPAC Name | propane;(E)-1,1,1-trifluoro-4-methyl-N-prop-1-en-2-ylhex-3-en-2-imine |
| SMILES | C=C(C)/N=C(/C=C(\C)CC)C(F)(F)F.CCC |
| InChI | InChI=1S/C10H14F3N.C3H8/c1-5-8(4)6-9(10(11,12)13)14-7(2)3;1-3-2/h6H,2,5H2,1,3-4H3;3H2,1-2H3/b8-6+,14-9-; |
| InChIKey | SPQOEJHUTQNNMQ-KZAPFTCMSA-N |
| XLogP | 5.30 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.32 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|