C9H10F3N — CID 14610094
5,7-dimethyl-2-(trifluoromethyl)-4H-azepine (PubChem CID 14610094) has the molecular formula C9H10F3N and a molecular weight of 189.18 g/mol. Its IUPAC name is 5,7-dimethyl-2-(trifluoromethyl)-4H-azepine.
| Compound Name | 5,7-dimethyl-2-(trifluoromethyl)-4H-azepine |
|---|---|
| PubChem CID | 14610094 |
| Molecular Formula | C9H10F3N |
| Molecular Weight | 189.18 g/mol |
| Exact Mass | 189.08 |
| IUPAC Name | 5,7-dimethyl-2-(trifluoromethyl)-4H-azepine |
| SMILES | CC1=CC(C)=NC(C(F)(F)F)=CC1 |
| InChI | InChI=1S/C9H10F3N/c1-6-3-4-8(9(10,11)12)13-7(2)5-6/h4-5H,3H2,1-2H3 |
| InChIKey | MAXWDMSUOJQCFR-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.18 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |