About (Z)-N-(3,3,3-trifluoroprop-1-en-2-yl)pent-3-en-2-imine
(Z)-N-(3,3,3-trifluoroprop-1-en-2-yl)pent-3-en-2-imine (PubChem CID 131996217) has the molecular formula C8H10F3N
and a molecular weight of 177.17 g/mol. Its IUPAC name is (Z)-N-(3,3,3-trifluoroprop-1-en-2-yl)pent-3-en-2-imine.
Molecular Properties
| Compound Name | (Z)-N-(3,3,3-trifluoroprop-1-en-2-yl)pent-3-en-2-imine |
| PubChem CID | 131996217 |
| Molecular Formula | C8H10F3N |
| Molecular Weight | 177.17 g/mol |
| Exact Mass | 177.08 |
| IUPAC Name | (Z)-N-(3,3,3-trifluoroprop-1-en-2-yl)pent-3-en-2-imine |
| SMILES | C=C(/N=C(C)/C=C\C)C(F)(F)F |
| InChI | InChI=1S/C8H10F3N/c1-4-5-6(2)12-7(3)8(9,10)11/h4-5H,3H2,1-2H3/b5-4-,12-6+ |
| InChIKey | JHFKKQUJTWDIJY-QENXGIAESA-N |
| XLogP | 3.10 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.17 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-N-(3,3,3-trifluoroprop-1-en-2-yl)pent-3-en-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-N-(3,3,3-trifluoroprop-1-en-2-yl)pent-3-en-2-imine?
The IUPAC name of (Z)-N-(3,3,3-trifluoroprop-1-en-2-yl)pent-3-en-2-imine (CID 131996217) is (Z)-N-(3,3,3-trifluoroprop-1-en-2-yl)pent-3-en-2-imine.
What is the SMILES notation for (Z)-N-(3,3,3-trifluoroprop-1-en-2-yl)pent-3-en-2-imine?
The canonical SMILES for (Z)-N-(3,3,3-trifluoroprop-1-en-2-yl)pent-3-en-2-imine is C=C(/N=C(C)/C=C\C)C(F)(F)F.
What is the InChIKey of (Z)-N-(3,3,3-trifluoroprop-1-en-2-yl)pent-3-en-2-imine?
The InChIKey is JHFKKQUJTWDIJY-QENXGIAESA-N. The full InChI is InChI=1S/C8H10F3N/c1-4-5-6(2)12-7(3)8(9,10)11/h4-5H,3H2,1-2H3/b5-4-,12-6+.
What are the key properties of (Z)-N-(3,3,3-trifluoroprop-1-en-2-yl)pent-3-en-2-imine?
(Z)-N-(3,3,3-trifluoroprop-1-en-2-yl)pent-3-en-2-imine has a molecular weight of 177.17 g/mol, XLogP of 3.10, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-N-(3,3,3-trifluoroprop-1-en-2-yl)pent-3-en-2-imine is sourced from PubChem (CID 131996217), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).