C8H11F3N2 — CID 137401028
(Z)-1,1,1-trifluoro-4-prop-1-en-2-yliminopent-2-en-2-amine (PubChem CID 137401028) has the molecular formula C8H11F3N2 and a molecular weight of 192.18 g/mol. Its IUPAC name is (Z)-1,1,1-trifluoro-4-prop-1-en-2-yliminopent-2-en-2-amine.
| Compound Name | (Z)-1,1,1-trifluoro-4-prop-1-en-2-yliminopent-2-en-2-amine |
|---|---|
| PubChem CID | 137401028 |
| Molecular Formula | C8H11F3N2 |
| Molecular Weight | 192.18 g/mol |
| Exact Mass | 192.09 |
| IUPAC Name | (Z)-1,1,1-trifluoro-4-prop-1-en-2-yliminopent-2-en-2-amine |
| SMILES | C=C(C)/N=C(C)/C=C(\N)C(F)(F)F |
| InChI | InChI=1S/C8H11F3N2/c1-5(2)13-6(3)4-7(12)8(9,10)11/h4H,1,12H2,2-3H3/b7-4-,13-6+ |
| InChIKey | VGGQPZWDQRJZLY-CTIXMVKPSA-N |
| XLogP | 2.39 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.18 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|