C8H13CuF3N2 — CID 87979812
copper;4-iminopent-2-en-2-amine;3,3,3-trifluoroprop-1-ene (PubChem CID 87979812) has the molecular formula C8H13CuF3N2 and a molecular weight of 257.75 g/mol. Its IUPAC name is copper;4-iminopent-2-en-2-amine;3,3,3-trifluoroprop-1-ene.
| Compound Name | copper;4-iminopent-2-en-2-amine;3,3,3-trifluoroprop-1-ene |
|---|---|
| PubChem CID | 87979812 |
| Molecular Formula | C8H13CuF3N2 |
| Molecular Weight | 257.75 g/mol |
| Exact Mass | 257.03 |
| IUPAC Name | copper;4-iminopent-2-en-2-amine;3,3,3-trifluoroprop-1-ene |
| SMILES | C=CC(F)(F)F.[Cu].[H]/N=C(\C)C=C(C)N |
| InChI | InChI=1S/C5H10N2.C3H3F3.Cu/c1-4(6)3-5(2)7;1-2-3(4,5)6;/h3,6H,7H2,1-2H3;2H,1H2;/b5-3?,6-4+;; |
| InChIKey | OPUGVFARHZERCE-OXFOGQRTSA-N |
| XLogP | 2.62 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.75 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|