C11H18N2 — CID 178005265
(3E,5E)-N,N,3,5-tetramethyl-6-(methylideneamino)hexa-1,3,5-trien-2-amine (PubChem CID 178005265) has the molecular formula C11H18N2 and a molecular weight of 178.28 g/mol. Its IUPAC name is (3E,5E)-N,N,3,5-tetramethyl-6-(methylideneamino)hexa-1,3,5-trien-2-amine.
| Compound Name | (3E,5E)-N,N,3,5-tetramethyl-6-(methylideneamino)hexa-1,3,5-trien-2-amine |
|---|---|
| PubChem CID | 178005265 |
| Molecular Formula | C11H18N2 |
| Molecular Weight | 178.28 g/mol |
| Exact Mass | 178.15 |
| IUPAC Name | (3E,5E)-N,N,3,5-tetramethyl-6-(methylideneamino)hexa-1,3,5-trien-2-amine |
| SMILES | C=N/C=C(C)/C=C(\C)C(=C)N(C)C |
| InChI | InChI=1S/C11H18N2/c1-9(8-12-4)7-10(2)11(3)13(5)6/h7-8H,3-4H2,1-2,5-6H3/b9-8+,10-7+ |
| InChIKey | SVSFTIITFIPNDL-DGLUDJRXSA-N |
| XLogP | 2.61 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.28 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|