C7H9NO — CID 118428989
(1E)-2-methyl-1-(methylideneamino)penta-1,4-dien-3-one (PubChem CID 118428989) has the molecular formula C7H9NO and a molecular weight of 123.15 g/mol. Its IUPAC name is (1E)-2-methyl-1-(methylideneamino)penta-1,4-dien-3-one.
| Compound Name | (1E)-2-methyl-1-(methylideneamino)penta-1,4-dien-3-one |
|---|---|
| PubChem CID | 118428989 |
| Molecular Formula | C7H9NO |
| Molecular Weight | 123.15 g/mol |
| Exact Mass | 123.07 |
| IUPAC Name | (1E)-2-methyl-1-(methylideneamino)penta-1,4-dien-3-one |
| SMILES | C=CC(=O)/C(C)=C/N=C |
| InChI | InChI=1S/C7H9NO/c1-4-7(9)6(2)5-8-3/h4-5H,1,3H2,2H3/b6-5+ |
| InChIKey | RLYVHTCGJNIQSV-AATRIKPKSA-N |
| XLogP | 1.35 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 123.15 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|