C5H7NO — CID 143277804
(1E)-1-(methylideneamino)buta-1,3-dien-2-ol (PubChem CID 143277804) has the molecular formula C5H7NO and a molecular weight of 97.12 g/mol. Its IUPAC name is (1E)-1-(methylideneamino)buta-1,3-dien-2-ol.
| Compound Name | (1E)-1-(methylideneamino)buta-1,3-dien-2-ol |
|---|---|
| PubChem CID | 143277804 |
| Molecular Formula | C5H7NO |
| Molecular Weight | 97.12 g/mol |
| Exact Mass | 97.05 |
| IUPAC Name | (1E)-1-(methylideneamino)buta-1,3-dien-2-ol |
| SMILES | C=C/C(O)=C\N=C |
| InChI | InChI=1S/C5H7NO/c1-3-5(7)4-6-2/h3-4,7H,1-2H2/b5-4+ |
| InChIKey | RBTLIOODBBPSMZ-SNAWJCMRSA-N |
| XLogP | 1.27 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 97.12 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|