C12H19NO2 — CID 165405457
(4E)-4-[(methylideneamino)methylidene]-3-(2-methylpropyl)hex-5-enoic acid (PubChem CID 165405457) has the molecular formula C12H19NO2 and a molecular weight of 209.29 g/mol. Its IUPAC name is (4E)-4-[(methylideneamino)methylidene]-3-(2-methylpropyl)hex-5-enoic acid.
| Compound Name | (4E)-4-[(methylideneamino)methylidene]-3-(2-methylpropyl)hex-5-enoic acid |
|---|---|
| PubChem CID | 165405457 |
| Molecular Formula | C12H19NO2 |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.14 |
| IUPAC Name | (4E)-4-[(methylideneamino)methylidene]-3-(2-methylpropyl)hex-5-enoic acid |
| SMILES | C=C/C(=C\N=C)C(CC(=O)O)CC(C)C |
| InChI | InChI=1S/C12H19NO2/c1-5-10(8-13-4)11(6-9(2)3)7-12(14)15/h5,8-9,11H,1,4,6-7H2,2-3H3,(H,14,15)/b10-8+ |
| InChIKey | NQGYLQXNVHPLCU-CSKARUKUSA-N |
| XLogP | 2.89 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|