C10H14O2 — CID 145439672
(3R,4E)-4-ethenyl-3-methylhepta-4,6-dienoic acid (PubChem CID 145439672) has the molecular formula C10H14O2 and a molecular weight of 166.22 g/mol. Its IUPAC name is (3R,4E)-4-ethenyl-3-methylhepta-4,6-dienoic acid.
| Compound Name | (3R,4E)-4-ethenyl-3-methylhepta-4,6-dienoic acid |
|---|---|
| PubChem CID | 145439672 |
| Molecular Formula | C10H14O2 |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.10 |
| IUPAC Name | (3R,4E)-4-ethenyl-3-methylhepta-4,6-dienoic acid |
| SMILES | C=C/C=C(\C=C)[C@H](C)CC(=O)O |
| InChI | InChI=1S/C10H14O2/c1-4-6-9(5-2)8(3)7-10(11)12/h4-6,8H,1-2,7H2,3H3,(H,11,12)/b9-6+/t8-/m1/s1 |
| InChIKey | UEOJBZPXINNPMB-GTUWVTDSSA-N |
| XLogP | 2.40 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|