About methyl N-methyl-N-[(1E)-1-(methylideneamino)buta-1,3-dien-2-yl]carbamate
methyl N-methyl-N-[(1E)-1-(methylideneamino)buta-1,3-dien-2-yl]carbamate (PubChem CID 143469115) has the molecular formula C8H12N2O2
and a molecular weight of 168.20 g/mol. Its IUPAC name is methyl N-methyl-N-[(1E)-1-(methylideneamino)buta-1,3-dien-2-yl]carbamate.
Molecular Properties
| Compound Name | methyl N-methyl-N-[(1E)-1-(methylideneamino)buta-1,3-dien-2-yl]carbamate |
| PubChem CID | 143469115 |
| Molecular Formula | C8H12N2O2 |
| Molecular Weight | 168.20 g/mol |
| Exact Mass | 168.09 |
| IUPAC Name | methyl N-methyl-N-[(1E)-1-(methylideneamino)buta-1,3-dien-2-yl]carbamate |
| SMILES | C=C/C(=C\N=C)N(C)C(=O)OC |
| InChI | InChI=1S/C8H12N2O2/c1-5-7(6-9-2)10(3)8(11)12-4/h5-6H,1-2H2,3-4H3/b7-6+ |
| InChIKey | QYURFCMRUSHQLB-VOTSOKGWSA-N |
| XLogP | 1.41 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.20 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze methyl N-methyl-N-[(1E)-1-(methylideneamino)buta-1,3-dien-2-yl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl N-methyl-N-[(1E)-1-(methylideneamino)buta-1,3-dien-2-yl]carbamate?
The IUPAC name of methyl N-methyl-N-[(1E)-1-(methylideneamino)buta-1,3-dien-2-yl]carbamate (CID 143469115) is methyl N-methyl-N-[(1E)-1-(methylideneamino)buta-1,3-dien-2-yl]carbamate.
What is the SMILES notation for methyl N-methyl-N-[(1E)-1-(methylideneamino)buta-1,3-dien-2-yl]carbamate?
The canonical SMILES for methyl N-methyl-N-[(1E)-1-(methylideneamino)buta-1,3-dien-2-yl]carbamate is C=C/C(=C\N=C)N(C)C(=O)OC.
What is the InChIKey of methyl N-methyl-N-[(1E)-1-(methylideneamino)buta-1,3-dien-2-yl]carbamate?
The InChIKey is QYURFCMRUSHQLB-VOTSOKGWSA-N. The full InChI is InChI=1S/C8H12N2O2/c1-5-7(6-9-2)10(3)8(11)12-4/h5-6H,1-2H2,3-4H3/b7-6+.
What are the key properties of methyl N-methyl-N-[(1E)-1-(methylideneamino)buta-1,3-dien-2-yl]carbamate?
methyl N-methyl-N-[(1E)-1-(methylideneamino)buta-1,3-dien-2-yl]carbamate has a molecular weight of 168.20 g/mol, XLogP of 1.41, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N-methyl-N-[(1E)-1-(methylideneamino)buta-1,3-dien-2-yl]carbamate is sourced from PubChem (CID 143469115), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).