C8H12N2O2 — CID 143469115
methyl N-methyl-N-[(1E)-1-(methylideneamino)buta-1,3-dien-2-yl]carbamate (PubChem CID 143469115) has the molecular formula C8H12N2O2 and a molecular weight of 168.20 g/mol. Its IUPAC name is methyl N-methyl-N-[(1E)-1-(methylideneamino)buta-1,3-dien-2-yl]carbamate.
| Compound Name | methyl N-methyl-N-[(1E)-1-(methylideneamino)buta-1,3-dien-2-yl]carbamate |
|---|---|
| PubChem CID | 143469115 |
| Molecular Formula | C8H12N2O2 |
| Molecular Weight | 168.20 g/mol |
| Exact Mass | 168.09 |
| IUPAC Name | methyl N-methyl-N-[(1E)-1-(methylideneamino)buta-1,3-dien-2-yl]carbamate |
| SMILES | C=C/C(=C\N=C)N(C)C(=O)OC |
| InChI | InChI=1S/C8H12N2O2/c1-5-7(6-9-2)10(3)8(11)12-4/h5-6H,1-2H2,3-4H3/b7-6+ |
| InChIKey | QYURFCMRUSHQLB-VOTSOKGWSA-N |
| XLogP | 1.41 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.20 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|