About dimethylamino prop-2-enoate
dimethylamino prop-2-enoate (PubChem CID 20697927) has the molecular formula C5H9NO2
and a molecular weight of 115.13 g/mol. Its IUPAC name is dimethylamino prop-2-enoate.
Molecular Properties
| Compound Name | dimethylamino prop-2-enoate |
| PubChem CID | 20697927 |
| Molecular Formula | C5H9NO2 |
| Molecular Weight | 115.13 g/mol |
| Exact Mass | 115.06 |
| IUPAC Name | dimethylamino prop-2-enoate |
| SMILES | C=CC(=O)ON(C)C |
| InChI | InChI=1S/C5H9NO2/c1-4-5(7)8-6(2)3/h4H,1H2,2-3H3 |
| InChIKey | HOSXICNCYBUYAW-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 115.13 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze dimethylamino prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethylamino prop-2-enoate?
The IUPAC name of dimethylamino prop-2-enoate (CID 20697927) is dimethylamino prop-2-enoate.
What is the SMILES notation for dimethylamino prop-2-enoate?
The canonical SMILES for dimethylamino prop-2-enoate is C=CC(=O)ON(C)C.
What is the InChIKey of dimethylamino prop-2-enoate?
The InChIKey is HOSXICNCYBUYAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9NO2/c1-4-5(7)8-6(2)3/h4H,1H2,2-3H3.
What are the key properties of dimethylamino prop-2-enoate?
dimethylamino prop-2-enoate has a molecular weight of 115.13 g/mol, XLogP of 0.19, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for dimethylamino prop-2-enoate is sourced from PubChem (CID 20697927), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).