C10H19N3O2 — CID 166715447
tert-butyl N-(N-ethenyl-N'-methylcarbamimidoyl)-N-methylcarbamate (PubChem CID 166715447) has the molecular formula C10H19N3O2 and a molecular weight of 213.28 g/mol. Its IUPAC name is tert-butyl N-(N-ethenyl-N'-methylcarbamimidoyl)-N-methylcarbamate.
| Compound Name | tert-butyl N-(N-ethenyl-N'-methylcarbamimidoyl)-N-methylcarbamate |
|---|---|
| PubChem CID | 166715447 |
| Molecular Formula | C10H19N3O2 |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.15 |
| IUPAC Name | tert-butyl N-(N-ethenyl-N'-methylcarbamimidoyl)-N-methylcarbamate |
| SMILES | C=CN/C(=N\C)N(C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C10H19N3O2/c1-7-12-8(11-5)13(6)9(14)15-10(2,3)4/h7H,1H2,2-6H3,(H,11,12) |
| InChIKey | ILSAOYVMXQYJQW-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|