C10H20N2O3 — CID 58446238
tert-butyl N-methyl-N-[2-(methylamino)propanoyl]carbamate (PubChem CID 58446238) has the molecular formula C10H20N2O3 and a molecular weight of 216.28 g/mol. Its IUPAC name is tert-butyl N-methyl-N-[2-(methylamino)propanoyl]carbamate.
| Compound Name | tert-butyl N-methyl-N-[2-(methylamino)propanoyl]carbamate |
|---|---|
| PubChem CID | 58446238 |
| Molecular Formula | C10H20N2O3 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.15 |
| IUPAC Name | tert-butyl N-methyl-N-[2-(methylamino)propanoyl]carbamate |
| SMILES | CNC(C)C(=O)N(C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C10H20N2O3/c1-7(11-5)8(13)12(6)9(14)15-10(2,3)4/h7,11H,1-6H3 |
| InChIKey | ZSAFIWSYHFPHEB-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |