C10H15NO6 — CID 102192656
methyl 3-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-2,3-dioxopropanoate (PubChem CID 102192656) has the molecular formula C10H15NO6 and a molecular weight of 245.23 g/mol. Its IUPAC name is methyl 3-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-2,3-dioxopropanoate.
| Compound Name | methyl 3-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-2,3-dioxopropanoate |
|---|---|
| PubChem CID | 102192656 |
| Molecular Formula | C10H15NO6 |
| Molecular Weight | 245.23 g/mol |
| Exact Mass | 245.09 |
| IUPAC Name | methyl 3-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-2,3-dioxopropanoate |
| SMILES | COC(=O)C(=O)C(=O)N(C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C10H15NO6/c1-10(2,3)17-9(15)11(4)7(13)6(12)8(14)16-5/h1-5H3 |
| InChIKey | PZZLDZPAQOBKAV-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.23 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|