C16H31N3O4 — CID 11034862
tert-butyl N-[(E)-N,N-diethyl-N'-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]-N-methylcarbamate (PubChem CID 11034862) has the molecular formula C16H31N3O4 and a molecular weight of 329.44 g/mol. Its IUPAC name is tert-butyl N-[(E)-N,N-diethyl-N'-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[(E)-N,N-diethyl-N'-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 11034862 |
| Molecular Formula | C16H31N3O4 |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.23 |
| IUPAC Name | tert-butyl N-[(E)-N,N-diethyl-N'-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]-N-methylcarbamate |
| SMILES | CCN(CC)/C(=N\C(=O)OC(C)(C)C)N(C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H31N3O4/c1-10-19(11-2)12(17-13(20)22-15(3,4)5)18(9)14(21)23-16(6,7)8/h10-11H2,1-9H3/b17-12- |
| InChIKey | UFEDGEFLXXXKGO-ATVHPVEESA-N |
| XLogP | 3.49 |
| TPSA | 71.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|