About azane;2-methylpenta-1,4-dien-3-one;hydrochloride
azane;2-methylpenta-1,4-dien-3-one;hydrochloride (PubChem CID 174999839) has the molecular formula C6H12ClNO
and a molecular weight of 149.62 g/mol. Its IUPAC name is azane;2-methylpenta-1,4-dien-3-one;hydrochloride.
Molecular Properties
| Compound Name | azane;2-methylpenta-1,4-dien-3-one;hydrochloride |
| PubChem CID | 174999839 |
| Molecular Formula | C6H12ClNO |
| Molecular Weight | 149.62 g/mol |
| Exact Mass | 149.06 |
| IUPAC Name | azane;2-methylpenta-1,4-dien-3-one;hydrochloride |
| SMILES | C=CC(=O)C(=C)C.Cl.N |
| InChI | InChI=1S/C6H8O.ClH.H3N/c1-4-6(7)5(2)3;;/h4H,1-2H2,3H3;1H;1H3 |
| InChIKey | ORDASVMTFRUKCP-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 52.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.62 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze azane;2-methylpenta-1,4-dien-3-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;2-methylpenta-1,4-dien-3-one;hydrochloride?
The IUPAC name of azane;2-methylpenta-1,4-dien-3-one;hydrochloride (CID 174999839) is azane;2-methylpenta-1,4-dien-3-one;hydrochloride.
What is the SMILES notation for azane;2-methylpenta-1,4-dien-3-one;hydrochloride?
The canonical SMILES for azane;2-methylpenta-1,4-dien-3-one;hydrochloride is C=CC(=O)C(=C)C.Cl.N.
What is the InChIKey of azane;2-methylpenta-1,4-dien-3-one;hydrochloride?
The InChIKey is ORDASVMTFRUKCP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8O.ClH.H3N/c1-4-6(7)5(2)3;;/h4H,1-2H2,3H3;1H;1H3.
What are the key properties of azane;2-methylpenta-1,4-dien-3-one;hydrochloride?
azane;2-methylpenta-1,4-dien-3-one;hydrochloride has a molecular weight of 149.62 g/mol, XLogP of 1.90, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for azane;2-methylpenta-1,4-dien-3-one;hydrochloride is sourced from PubChem (CID 174999839), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).