C6H12ClNO — CID 174999839
azane;2-methylpenta-1,4-dien-3-one;hydrochloride (PubChem CID 174999839) has the molecular formula C6H12ClNO and a molecular weight of 149.62 g/mol. Its IUPAC name is azane;2-methylpenta-1,4-dien-3-one;hydrochloride.
| Compound Name | azane;2-methylpenta-1,4-dien-3-one;hydrochloride |
|---|---|
| PubChem CID | 174999839 |
| Molecular Formula | C6H12ClNO |
| Molecular Weight | 149.62 g/mol |
| Exact Mass | 149.06 |
| IUPAC Name | azane;2-methylpenta-1,4-dien-3-one;hydrochloride |
| SMILES | C=CC(=O)C(=C)C.Cl.N |
| InChI | InChI=1S/C6H8O.ClH.H3N/c1-4-6(7)5(2)3;;/h4H,1-2H2,3H3;1H;1H3 |
| InChIKey | ORDASVMTFRUKCP-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 52.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.62 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|