C13H16FN — CID 170568622
N-[(1Z,4E,6E)-2-ethenyl-7-fluoro-4-methyl-3-methylideneocta-1,4,6-trienyl]methanimine (PubChem CID 170568622) has the molecular formula C13H16FN and a molecular weight of 205.28 g/mol. Its IUPAC name is N-[(1Z,4E,6E)-2-ethenyl-7-fluoro-4-methyl-3-methylideneocta-1,4,6-trienyl]methanimine.
| Compound Name | N-[(1Z,4E,6E)-2-ethenyl-7-fluoro-4-methyl-3-methylideneocta-1,4,6-trienyl]methanimine |
|---|---|
| PubChem CID | 170568622 |
| Molecular Formula | C13H16FN |
| Molecular Weight | 205.28 g/mol |
| Exact Mass | 205.13 |
| IUPAC Name | N-[(1Z,4E,6E)-2-ethenyl-7-fluoro-4-methyl-3-methylideneocta-1,4,6-trienyl]methanimine |
| SMILES | C=C/C(=C/N=C)C(=C)/C(C)=C/C=C(\C)F |
| InChI | InChI=1S/C13H16FN/c1-6-13(9-15-5)12(4)10(2)7-8-11(3)14/h6-9H,1,4-5H2,2-3H3/b10-7+,11-8+,13-9- |
| InChIKey | XQISVSNGSQXNEY-GUYZQJHSSA-N |
| XLogP | 4.13 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.28 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|