C13H17N — CID 142924212
(3E,6Z)-6-ethenyl-3-methyl-5-methylidenenona-1,3,6,8-tetraen-2-amine (PubChem CID 142924212) has the molecular formula C13H17N and a molecular weight of 187.29 g/mol. Its IUPAC name is (3E,6Z)-6-ethenyl-3-methyl-5-methylidenenona-1,3,6,8-tetraen-2-amine.
| Compound Name | (3E,6Z)-6-ethenyl-3-methyl-5-methylidenenona-1,3,6,8-tetraen-2-amine |
|---|---|
| PubChem CID | 142924212 |
| Molecular Formula | C13H17N |
| Molecular Weight | 187.29 g/mol |
| Exact Mass | 187.14 |
| IUPAC Name | (3E,6Z)-6-ethenyl-3-methyl-5-methylidenenona-1,3,6,8-tetraen-2-amine |
| SMILES | C=C/C=C(/C=C)C(=C)/C=C(\C)C(=C)N |
| InChI | InChI=1S/C13H17N/c1-6-8-13(7-2)11(4)9-10(3)12(5)14/h6-9H,1-2,4-5,14H2,3H3/b10-9+,13-8- |
| InChIKey | XYJQIPMXILKQHW-YFWLALPLSA-N |
| XLogP | 3.26 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.29 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|