C7H10BrN — CID 135198890
(2E,4E)-4-bromohepta-2,4,6-trien-3-amine (PubChem CID 135198890) has the molecular formula C7H10BrN and a molecular weight of 188.07 g/mol. Its IUPAC name is (2E,4E)-4-bromohepta-2,4,6-trien-3-amine.
| Compound Name | (2E,4E)-4-bromohepta-2,4,6-trien-3-amine |
|---|---|
| PubChem CID | 135198890 |
| Molecular Formula | C7H10BrN |
| Molecular Weight | 188.07 g/mol |
| Exact Mass | 187.00 |
| IUPAC Name | (2E,4E)-4-bromohepta-2,4,6-trien-3-amine |
| SMILES | C=C/C=C(Br)\C(N)=C/C |
| InChI | InChI=1S/C7H10BrN/c1-3-5-6(8)7(9)4-2/h3-5H,1,9H2,2H3/b6-5+,7-4+ |
| InChIKey | GWCKTUBIQDXZQY-HVUXDCMCSA-N |
| XLogP | 2.31 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.07 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|