C8H14N2 — CID 143142825
(2Z,3E)-2-ethylidenehexa-3,5-diene-1,3-diamine (PubChem CID 143142825) has the molecular formula C8H14N2 and a molecular weight of 138.21 g/mol. Its IUPAC name is (2Z,3E)-2-ethylidenehexa-3,5-diene-1,3-diamine.
| Compound Name | (2Z,3E)-2-ethylidenehexa-3,5-diene-1,3-diamine |
|---|---|
| PubChem CID | 143142825 |
| Molecular Formula | C8H14N2 |
| Molecular Weight | 138.21 g/mol |
| Exact Mass | 138.12 |
| IUPAC Name | (2Z,3E)-2-ethylidenehexa-3,5-diene-1,3-diamine |
| SMILES | C=C/C=C(N)\C(=C/C)CN |
| InChI | InChI=1S/C8H14N2/c1-3-5-8(10)7(4-2)6-9/h3-5H,1,6,9-10H2,2H3/b7-4-,8-5+ |
| InChIKey | HTMDEWJCSUNFNZ-DKBJKEKUSA-N |
| XLogP | 0.92 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.21 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|