C5H8N2O — CID 88558803
(2Z)-2-aminopenta-2,4-dienamide (PubChem CID 88558803) has the molecular formula C5H8N2O and a molecular weight of 112.13 g/mol. Its IUPAC name is (2Z)-2-aminopenta-2,4-dienamide.
| Compound Name | (2Z)-2-aminopenta-2,4-dienamide |
|---|---|
| PubChem CID | 88558803 |
| Molecular Formula | C5H8N2O |
| Molecular Weight | 112.13 g/mol |
| Exact Mass | 112.06 |
| IUPAC Name | (2Z)-2-aminopenta-2,4-dienamide |
| SMILES | C=C/C=C(\N)C(N)=O |
| InChI | InChI=1S/C5H8N2O/c1-2-3-4(6)5(7)8/h2-3H,1,6H2,(H2,7,8)/b4-3- |
| InChIKey | POSPAXJKWKDRKR-ARJAWSKDSA-N |
| XLogP | -0.50 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 112.13 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|