C7H10N2O — CID 143715674
(2E)-2-(methyliminomethyl)penta-2,4-dienamide (PubChem CID 143715674) has the molecular formula C7H10N2O and a molecular weight of 138.17 g/mol. Its IUPAC name is (2E)-2-(methyliminomethyl)penta-2,4-dienamide.
| Compound Name | (2E)-2-(methyliminomethyl)penta-2,4-dienamide |
|---|---|
| PubChem CID | 143715674 |
| Molecular Formula | C7H10N2O |
| Molecular Weight | 138.17 g/mol |
| Exact Mass | 138.08 |
| IUPAC Name | (2E)-2-(methyliminomethyl)penta-2,4-dienamide |
| SMILES | C=C/C=C(\C=N\C)C(N)=O |
| InChI | InChI=1S/C7H10N2O/c1-3-4-6(5-9-2)7(8)10/h3-5H,1H2,2H3,(H2,8,10)/b6-4+,9-5+ |
| InChIKey | HSEIRTYQIGNHOD-REZHQCRGSA-N |
| XLogP | 0.28 |
| TPSA | 55.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.17 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|