C12H17NO3 — CID 143019358
(3E,5E)-5-amino-3-ethenyl-2-oxoocta-3,5,7-trienoic acid;ethane (PubChem CID 143019358) has the molecular formula C12H17NO3 and a molecular weight of 223.27 g/mol. Its IUPAC name is (3E,5E)-5-amino-3-ethenyl-2-oxoocta-3,5,7-trienoic acid;ethane.
| Compound Name | (3E,5E)-5-amino-3-ethenyl-2-oxoocta-3,5,7-trienoic acid;ethane |
|---|---|
| PubChem CID | 143019358 |
| Molecular Formula | C12H17NO3 |
| Molecular Weight | 223.27 g/mol |
| Exact Mass | 223.12 |
| IUPAC Name | (3E,5E)-5-amino-3-ethenyl-2-oxoocta-3,5,7-trienoic acid;ethane |
| SMILES | C=C/C=C(N)\C=C(/C=C)C(=O)C(=O)O.CC |
| InChI | InChI=1S/C10H11NO3.C2H6/c1-3-5-8(11)6-7(4-2)9(12)10(13)14;1-2/h3-6H,1-2,11H2,(H,13,14);1-2H3/b7-6+,8-5+; |
| InChIKey | JNZMCTXXTIVBIV-SGVYSVLESA-N |
| XLogP | 1.81 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.27 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|