C11H16N2O3 — CID 163636212
(2E)-2-[(E)-2-amino-2-(2-methylpropanoylamino)ethenyl]penta-2,4-dienoic acid (PubChem CID 163636212) has the molecular formula C11H16N2O3 and a molecular weight of 224.26 g/mol. Its IUPAC name is (2E)-2-[(E)-2-amino-2-(2-methylpropanoylamino)ethenyl]penta-2,4-dienoic acid.
| Compound Name | (2E)-2-[(E)-2-amino-2-(2-methylpropanoylamino)ethenyl]penta-2,4-dienoic acid |
|---|---|
| PubChem CID | 163636212 |
| Molecular Formula | C11H16N2O3 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.12 |
| IUPAC Name | (2E)-2-[(E)-2-amino-2-(2-methylpropanoylamino)ethenyl]penta-2,4-dienoic acid |
| SMILES | C=C/C=C(\C=C(/N)NC(=O)C(C)C)C(=O)O |
| InChI | InChI=1S/C11H16N2O3/c1-4-5-8(11(15)16)6-9(12)13-10(14)7(2)3/h4-7H,1,12H2,2-3H3,(H,13,14)(H,15,16)/b8-5+,9-6+ |
| InChIKey | IAHZLSJVNVLZTH-XVYDYJIPSA-N |
| XLogP | 0.76 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|