About (2-methylpropanoylamino) prop-2-enoate
(2-methylpropanoylamino) prop-2-enoate (PubChem CID 176734642) has the molecular formula C7H11NO3
and a molecular weight of 157.17 g/mol. Its IUPAC name is (2-methylpropanoylamino) prop-2-enoate.
Molecular Properties
| Compound Name | (2-methylpropanoylamino) prop-2-enoate |
| PubChem CID | 176734642 |
| Molecular Formula | C7H11NO3 |
| Molecular Weight | 157.17 g/mol |
| Exact Mass | 157.07 |
| IUPAC Name | (2-methylpropanoylamino) prop-2-enoate |
| SMILES | C=CC(=O)ONC(=O)C(C)C |
| InChI | InChI=1S/C7H11NO3/c1-4-6(9)11-8-7(10)5(2)3/h4-5H,1H2,2-3H3,(H,8,10) |
| InChIKey | PWQKNHZQORWSDU-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.17 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2-methylpropanoylamino) prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methylpropanoylamino) prop-2-enoate?
The IUPAC name of (2-methylpropanoylamino) prop-2-enoate (CID 176734642) is (2-methylpropanoylamino) prop-2-enoate.
What is the SMILES notation for (2-methylpropanoylamino) prop-2-enoate?
The canonical SMILES for (2-methylpropanoylamino) prop-2-enoate is C=CC(=O)ONC(=O)C(C)C.
What is the InChIKey of (2-methylpropanoylamino) prop-2-enoate?
The InChIKey is PWQKNHZQORWSDU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11NO3/c1-4-6(9)11-8-7(10)5(2)3/h4-5H,1H2,2-3H3,(H,8,10).
What are the key properties of (2-methylpropanoylamino) prop-2-enoate?
(2-methylpropanoylamino) prop-2-enoate has a molecular weight of 157.17 g/mol, XLogP of 0.40, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methylpropanoylamino) prop-2-enoate is sourced from PubChem (CID 176734642), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).