About 1-(carbamoylamino)ethyl prop-2-enoate
1-(carbamoylamino)ethyl prop-2-enoate (PubChem CID 22146186) has the molecular formula C6H10N2O3
and a molecular weight of 158.16 g/mol. Its IUPAC name is 1-(carbamoylamino)ethyl prop-2-enoate.
Molecular Properties
| Compound Name | 1-(carbamoylamino)ethyl prop-2-enoate |
| PubChem CID | 22146186 |
| Molecular Formula | C6H10N2O3 |
| Molecular Weight | 158.16 g/mol |
| Exact Mass | 158.07 |
| IUPAC Name | 1-(carbamoylamino)ethyl prop-2-enoate |
| SMILES | C=CC(=O)OC(C)NC(N)=O |
| InChI | InChI=1S/C6H10N2O3/c1-3-5(9)11-4(2)8-6(7)10/h3-4H,1H2,2H3,(H3,7,8,10) |
| InChIKey | POFUDMKIZAMFSQ-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.16 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 1-(carbamoylamino)ethyl prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(carbamoylamino)ethyl prop-2-enoate?
The IUPAC name of 1-(carbamoylamino)ethyl prop-2-enoate (CID 22146186) is 1-(carbamoylamino)ethyl prop-2-enoate.
What is the SMILES notation for 1-(carbamoylamino)ethyl prop-2-enoate?
The canonical SMILES for 1-(carbamoylamino)ethyl prop-2-enoate is C=CC(=O)OC(C)NC(N)=O.
What is the InChIKey of 1-(carbamoylamino)ethyl prop-2-enoate?
The InChIKey is POFUDMKIZAMFSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N2O3/c1-3-5(9)11-4(2)8-6(7)10/h3-4H,1H2,2H3,(H3,7,8,10).
What are the key properties of 1-(carbamoylamino)ethyl prop-2-enoate?
1-(carbamoylamino)ethyl prop-2-enoate has a molecular weight of 158.16 g/mol, XLogP of -0.27, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(carbamoylamino)ethyl prop-2-enoate is sourced from PubChem (CID 22146186), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).