About 1-ethenoxyethylurea
1-ethenoxyethylurea (PubChem CID 19078685) has the molecular formula C5H10N2O2
and a molecular weight of 130.15 g/mol. Its IUPAC name is 1-ethenoxyethylurea.
Molecular Properties
| Compound Name | 1-ethenoxyethylurea |
| PubChem CID | 19078685 |
| Molecular Formula | C5H10N2O2 |
| Molecular Weight | 130.15 g/mol |
| Exact Mass | 130.07 |
| IUPAC Name | 1-ethenoxyethylurea |
| SMILES | C=COC(C)NC(N)=O |
| InChI | InChI=1S/C5H10N2O2/c1-3-9-4(2)7-5(6)8/h3-4H,1H2,2H3,(H3,6,7,8) |
| InChIKey | ZCXZBPRJLPXFPW-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.15 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-ethenoxyethylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethenoxyethylurea?
The IUPAC name of 1-ethenoxyethylurea (CID 19078685) is 1-ethenoxyethylurea.
What is the SMILES notation for 1-ethenoxyethylurea?
The canonical SMILES for 1-ethenoxyethylurea is C=COC(C)NC(N)=O.
What is the InChIKey of 1-ethenoxyethylurea?
The InChIKey is ZCXZBPRJLPXFPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10N2O2/c1-3-9-4(2)7-5(6)8/h3-4H,1H2,2H3,(H3,6,7,8).
What are the key properties of 1-ethenoxyethylurea?
1-ethenoxyethylurea has a molecular weight of 130.15 g/mol, XLogP of 0.16, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethenoxyethylurea is sourced from PubChem (CID 19078685), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).